C14H24N4O5 — CID 91181663
4-[[4-(ethoxycarbonylamino)piperidin-4-yl]methyl]-3-oxopiperazine-1-carboxylic acid (PubChem CID 91181663) has the molecular formula C14H24N4O5 and a molecular weight of 328.37 g/mol. Its IUPAC name is 4-[[4-(ethoxycarbonylamino)piperidin-4-yl]methyl]-3-oxopiperazine-1-carboxylic acid.
| Compound Name | 4-[[4-(ethoxycarbonylamino)piperidin-4-yl]methyl]-3-oxopiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 91181663 |
| Molecular Formula | C14H24N4O5 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 4-[[4-(ethoxycarbonylamino)piperidin-4-yl]methyl]-3-oxopiperazine-1-carboxylic acid |
| SMILES | CCOC(=O)NC1(CN2CCN(C(=O)O)CC2=O)CCNCC1 |
| InChI | InChI=1S/C14H24N4O5/c1-2-23-12(20)16-14(3-5-15-6-4-14)10-18-8-7-17(13(21)22)9-11(18)19/h15H,2-10H2,1H3,(H,16,20)(H,21,22) |
| InChIKey | BLZSXRONSRARFH-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |