C15H13ClN6O4S2 — CID 91184306
1-(5-chlorothiophen-2-yl)sulfonyl-4-pteridin-7-ylpiperazine-2-carboxylic acid (PubChem CID 91184306) has the molecular formula C15H13ClN6O4S2 and a molecular weight of 440.89 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-4-pteridin-7-ylpiperazine-2-carboxylic acid.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-4-pteridin-7-ylpiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 91184306 |
| Molecular Formula | C15H13ClN6O4S2 |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.01 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-4-pteridin-7-ylpiperazine-2-carboxylic acid |
| SMILES | O=C(O)C1CN(c2cnc3cncnc3n2)CCN1S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H13ClN6O4S2/c16-11-1-2-13(27-11)28(25,26)22-4-3-21(7-10(22)15(23)24)12-6-18-9-5-17-8-19-14(9)20-12/h1-2,5-6,8,10H,3-4,7H2,(H,23,24) |
| InChIKey | YACPNHWHYSVVOX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 129.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |