C19H25N3O2 — CID 91184592
(4R,5aR,9aR)-4-(2-methoxyphenyl)-5-methyl-4,5a,6,7,8,9,9a,10-octahydro-2H-pyrrolo[3,4-c][1,5]benzodiazepin-3-ol (PubChem CID 91184592) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is (4R,5aR,9aR)-4-(2-methoxyphenyl)-5-methyl-4,5a,6,7,8,9,9a,10-octahydro-2H-pyrrolo[3,4-c][1,5]benzodiazepin-3-ol.
| Compound Name | (4R,5aR,9aR)-4-(2-methoxyphenyl)-5-methyl-4,5a,6,7,8,9,9a,10-octahydro-2H-pyrrolo[3,4-c][1,5]benzodiazepin-3-ol |
|---|---|
| PubChem CID | 91184592 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | (4R,5aR,9aR)-4-(2-methoxyphenyl)-5-methyl-4,5a,6,7,8,9,9a,10-octahydro-2H-pyrrolo[3,4-c][1,5]benzodiazepin-3-ol |
| SMILES | COc1ccccc1[C@@H]1c2c(c[nH]c2O)N[C@@H]2CCCC[C@H]2N1C |
| InChI | InChI=1S/C19H25N3O2/c1-22-15-9-5-4-8-13(15)21-14-11-20-19(23)17(14)18(22)12-7-3-6-10-16(12)24-2/h3,6-7,10-11,13,15,18,20-21,23H,4-5,8-9H2,1-2H3/t13-,15-,18-/m1/s1 |
| InChIKey | WPTKFDDUWGGKOP-DDUZABMNSA-N |
| XLogP | 3.49 |
| TPSA | 60.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |