C18H18N4O2S2 — CID 3713375
1,5-bis(2-methoxyphenyl)-1,2,5,6-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione (PubChem CID 3713375) has the molecular formula C18H18N4O2S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 1,5-bis(2-methoxyphenyl)-1,2,5,6-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione.
| Compound Name | 1,5-bis(2-methoxyphenyl)-1,2,5,6-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione |
|---|---|
| PubChem CID | 3713375 |
| Molecular Formula | C18H18N4O2S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 1,5-bis(2-methoxyphenyl)-1,2,5,6-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione |
| SMILES | COc1ccccc1C1NC(=S)N2C(c3ccccc3OC)NC(=S)N12 |
| InChI | InChI=1S/C18H18N4O2S2/c1-23-13-9-5-3-7-11(13)15-19-17(25)22-16(20-18(26)21(15)22)12-8-4-6-10-14(12)24-2/h3-10,15-16H,1-2H3,(H,19,25)(H,20,26) |
| InChIKey | GHBKWSHWQIPQLU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 49.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|