C25H27Cl2FN4O3 — CID 91185579
(E)-4-cyclohexyl-1-[2-(2,6-dichloro-4-fluoroanilino)-5-(2-methoxyethoxy)-1H-imidazo[4,5-b]pyridin-6-yl]but-2-en-1-one (PubChem CID 91185579) has the molecular formula C25H27Cl2FN4O3 and a molecular weight of 521.42 g/mol. Its IUPAC name is (E)-4-cyclohexyl-1-[2-(2,6-dichloro-4-fluoroanilino)-5-(2-methoxyethoxy)-1H-imidazo[4,5-b]pyridin-6-yl]but-2-en-1-one.
| Compound Name | (E)-4-cyclohexyl-1-[2-(2,6-dichloro-4-fluoroanilino)-5-(2-methoxyethoxy)-1H-imidazo[4,5-b]pyridin-6-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 91185579 |
| Molecular Formula | C25H27Cl2FN4O3 |
| Molecular Weight | 521.42 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | (E)-4-cyclohexyl-1-[2-(2,6-dichloro-4-fluoroanilino)-5-(2-methoxyethoxy)-1H-imidazo[4,5-b]pyridin-6-yl]but-2-en-1-one |
| SMILES | COCCOc1nc2nc(Nc3c(Cl)cc(F)cc3Cl)[nH]c2cc1C(=O)/C=C/CC1CCCCC1 |
| InChI | InChI=1S/C25H27Cl2FN4O3/c1-34-10-11-35-24-17(21(33)9-5-8-15-6-3-2-4-7-15)14-20-23(31-24)32-25(29-20)30-22-18(26)12-16(28)13-19(22)27/h5,9,12-15H,2-4,6-8,10-11H2,1H3,(H2,29,30,31,32)/b9-5+ |
| InChIKey | AJWDJWCWOPYMTR-WEVVVXLNSA-N |
| XLogP | 6.88 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.42 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|