About triethoxysilyl 4-sulfanylhexanoate
triethoxysilyl 4-sulfanylhexanoate (PubChem CID 91185963) has the molecular formula C12H26O5SSi
and a molecular weight of 310.49 g/mol. Its IUPAC name is triethoxysilyl 4-sulfanylhexanoate.
Molecular Properties
| Compound Name | triethoxysilyl 4-sulfanylhexanoate |
| PubChem CID | 91185963 |
| Molecular Formula | C12H26O5SSi |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | triethoxysilyl 4-sulfanylhexanoate |
| SMILES | CCO[Si](OCC)(OCC)OC(=O)CCC(S)CC |
| InChI | InChI=1S/C12H26O5SSi/c1-5-11(18)9-10-12(13)17-19(14-6-2,15-7-3)16-8-4/h11,18H,5-10H2,1-4H3 |
| InChIKey | QDFZXPGESMLLLN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 53.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze triethoxysilyl 4-sulfanylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethoxysilyl 4-sulfanylhexanoate?
The IUPAC name of triethoxysilyl 4-sulfanylhexanoate (CID 91185963) is triethoxysilyl 4-sulfanylhexanoate.
What is the SMILES notation for triethoxysilyl 4-sulfanylhexanoate?
The canonical SMILES for triethoxysilyl 4-sulfanylhexanoate is CCO[Si](OCC)(OCC)OC(=O)CCC(S)CC.
What is the InChIKey of triethoxysilyl 4-sulfanylhexanoate?
The InChIKey is QDFZXPGESMLLLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O5SSi/c1-5-11(18)9-10-12(13)17-19(14-6-2,15-7-3)16-8-4/h11,18H,5-10H2,1-4H3.
What are the key properties of triethoxysilyl 4-sulfanylhexanoate?
triethoxysilyl 4-sulfanylhexanoate has a molecular weight of 310.49 g/mol, XLogP of 2.56, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for triethoxysilyl 4-sulfanylhexanoate is sourced from PubChem (CID 91185963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).