About [diethoxy(methyl)silyl] 5-sulfanylpentanoate
[diethoxy(methyl)silyl] 5-sulfanylpentanoate (PubChem CID 90805416) has the molecular formula C10H22O4SSi
and a molecular weight of 266.43 g/mol. Its IUPAC name is [diethoxy(methyl)silyl] 5-sulfanylpentanoate.
Molecular Properties
| Compound Name | [diethoxy(methyl)silyl] 5-sulfanylpentanoate |
| PubChem CID | 90805416 |
| Molecular Formula | C10H22O4SSi |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | [diethoxy(methyl)silyl] 5-sulfanylpentanoate |
| SMILES | CCO[Si](C)(OCC)OC(=O)CCCCS |
| InChI | InChI=1S/C10H22O4SSi/c1-4-12-16(3,13-5-2)14-10(11)8-6-7-9-15/h15H,4-9H2,1-3H3 |
| InChIKey | SYYKNVUOIATTLT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [diethoxy(methyl)silyl] 5-sulfanylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diethoxy(methyl)silyl] 5-sulfanylpentanoate?
The IUPAC name of [diethoxy(methyl)silyl] 5-sulfanylpentanoate (CID 90805416) is [diethoxy(methyl)silyl] 5-sulfanylpentanoate.
What is the SMILES notation for [diethoxy(methyl)silyl] 5-sulfanylpentanoate?
The canonical SMILES for [diethoxy(methyl)silyl] 5-sulfanylpentanoate is CCO[Si](C)(OCC)OC(=O)CCCCS.
What is the InChIKey of [diethoxy(methyl)silyl] 5-sulfanylpentanoate?
The InChIKey is SYYKNVUOIATTLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O4SSi/c1-4-12-16(3,13-5-2)14-10(11)8-6-7-9-15/h15H,4-9H2,1-3H3.
What are the key properties of [diethoxy(methyl)silyl] 5-sulfanylpentanoate?
[diethoxy(methyl)silyl] 5-sulfanylpentanoate has a molecular weight of 266.43 g/mol, XLogP of 2.27, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [diethoxy(methyl)silyl] 5-sulfanylpentanoate is sourced from PubChem (CID 90805416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).