C9H20O4S2Si — CID 87594075
[diethoxy(methyl)silyl] 2,2-bis(sulfanyl)butanoate (PubChem CID 87594075) has the molecular formula C9H20O4S2Si and a molecular weight of 284.47 g/mol. Its IUPAC name is [diethoxy(methyl)silyl] 2,2-bis(sulfanyl)butanoate.
| Compound Name | [diethoxy(methyl)silyl] 2,2-bis(sulfanyl)butanoate |
|---|---|
| PubChem CID | 87594075 |
| Molecular Formula | C9H20O4S2Si |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | [diethoxy(methyl)silyl] 2,2-bis(sulfanyl)butanoate |
| SMILES | CCO[Si](C)(OCC)OC(=O)C(S)(S)CC |
| InChI | InChI=1S/C9H20O4S2Si/c1-5-9(14,15)8(10)13-16(4,11-6-2)12-7-3/h14-15H,5-7H2,1-4H3 |
| InChIKey | YQMBTBBFROYXNC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|