About potassium;O-[diethoxy(methyl)silyl] ethanethioate;hydride
potassium;O-[diethoxy(methyl)silyl] ethanethioate;hydride (PubChem CID 173116192) has the molecular formula C7H17KO3SSi
and a molecular weight of 248.46 g/mol. Its IUPAC name is potassium;O-[diethoxy(methyl)silyl] ethanethioate;hydride.
Molecular Properties
| Compound Name | potassium;O-[diethoxy(methyl)silyl] ethanethioate;hydride |
| PubChem CID | 173116192 |
| Molecular Formula | C7H17KO3SSi |
| Molecular Weight | 248.46 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | potassium;O-[diethoxy(methyl)silyl] ethanethioate;hydride |
| SMILES | CCO[Si](C)(OCC)OC(C)=S.[H-].[K+] |
| InChI | InChI=1S/C7H16O3SSi.K.H/c1-5-8-12(4,9-6-2)10-7(3)11;;/h5-6H2,1-4H3;;/q;+1;-1 |
| InChIKey | IXAFOWVUSJSBRV-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.46 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze potassium;O-[diethoxy(methyl)silyl] ethanethioate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;O-[diethoxy(methyl)silyl] ethanethioate;hydride?
The IUPAC name of potassium;O-[diethoxy(methyl)silyl] ethanethioate;hydride (CID 173116192) is potassium;O-[diethoxy(methyl)silyl] ethanethioate;hydride.
What is the SMILES notation for potassium;O-[diethoxy(methyl)silyl] ethanethioate;hydride?
The canonical SMILES for potassium;O-[diethoxy(methyl)silyl] ethanethioate;hydride is CCO[Si](C)(OCC)OC(C)=S.[H-].[K+].
What is the InChIKey of potassium;O-[diethoxy(methyl)silyl] ethanethioate;hydride?
The InChIKey is IXAFOWVUSJSBRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O3SSi.K.H/c1-5-8-12(4,9-6-2)10-7(3)11;;/h5-6H2,1-4H3;;/q;+1;-1.
What are the key properties of potassium;O-[diethoxy(methyl)silyl] ethanethioate;hydride?
potassium;O-[diethoxy(methyl)silyl] ethanethioate;hydride has a molecular weight of 248.46 g/mol, XLogP of -0.89, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;O-[diethoxy(methyl)silyl] ethanethioate;hydride is sourced from PubChem (CID 173116192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).