[diethoxy(methyl)silyl] 3,3-bis(sulfanyl)pentanoate

C10H22O4S2Si — CID 87594957

IUPAC[diethoxy(methyl)silyl] 3,3-bis(sulfanyl)pentanoate
SMILESCCO[Si](C)(OCC)OC(=O)CC(S)(S)CC
InChIInChI=1S/C10H22O4S2Si/c1-5-10(15,16)8-9(11)14-17(4,12-6-2)13-7-3/h15-16H,5-8H2,1-4H3
InChIKeyVXGHVKCOZMFXIN-UHFFFAOYSA-N
MW298.50 g/mol
LogP2.53
Rot. Bonds8

About [diethoxy(methyl)silyl] 3,3-bis(sulfanyl)pentanoate

[diethoxy(methyl)silyl] 3,3-bis(sulfanyl)pentanoate (PubChem CID 87594957) has the molecular formula C10H22O4S2Si and a molecular weight of 298.50 g/mol. Its IUPAC name is [diethoxy(methyl)silyl] 3,3-bis(sulfanyl)pentanoate.

Molecular Properties

Compound Name[diethoxy(methyl)silyl] 3,3-bis(sulfanyl)pentanoate
PubChem CID87594957
Molecular FormulaC10H22O4S2Si
Molecular Weight298.50 g/mol
Exact Mass298.07
IUPAC Name[diethoxy(methyl)silyl] 3,3-bis(sulfanyl)pentanoate
SMILESCCO[Si](C)(OCC)OC(=O)CC(S)(S)CC
InChIInChI=1S/C10H22O4S2Si/c1-5-10(15,16)8-9(11)14-17(4,12-6-2)13-7-3/h15-16H,5-8H2,1-4H3
InChIKeyVXGHVKCOZMFXIN-UHFFFAOYSA-N
XLogP2.53
TPSA44.76 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.50
LogP ≤ 52.53
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze [diethoxy(methyl)silyl] 3,3-bis(sulfanyl)pentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [diethoxy(methyl)silyl] 3,3-bis(sulfanyl)pentanoate?
The IUPAC name of [diethoxy(methyl)silyl] 3,3-bis(sulfanyl)pentanoate (CID 87594957) is [diethoxy(methyl)silyl] 3,3-bis(sulfanyl)pentanoate.
What is the SMILES notation for [diethoxy(methyl)silyl] 3,3-bis(sulfanyl)pentanoate?
The canonical SMILES for [diethoxy(methyl)silyl] 3,3-bis(sulfanyl)pentanoate is CCO[Si](C)(OCC)OC(=O)CC(S)(S)CC.
What is the InChIKey of [diethoxy(methyl)silyl] 3,3-bis(sulfanyl)pentanoate?
The InChIKey is VXGHVKCOZMFXIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O4S2Si/c1-5-10(15,16)8-9(11)14-17(4,12-6-2)13-7-3/h15-16H,5-8H2,1-4H3.
What are the key properties of [diethoxy(methyl)silyl] 3,3-bis(sulfanyl)pentanoate?
[diethoxy(methyl)silyl] 3,3-bis(sulfanyl)pentanoate has a molecular weight of 298.50 g/mol, XLogP of 2.53, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [diethoxy(methyl)silyl] 3,3-bis(sulfanyl)pentanoate is sourced from PubChem (CID 87594957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).