C10H22O4S2Si — CID 87594957
[diethoxy(methyl)silyl] 3,3-bis(sulfanyl)pentanoate (PubChem CID 87594957) has the molecular formula C10H22O4S2Si and a molecular weight of 298.50 g/mol. Its IUPAC name is [diethoxy(methyl)silyl] 3,3-bis(sulfanyl)pentanoate.
| Compound Name | [diethoxy(methyl)silyl] 3,3-bis(sulfanyl)pentanoate |
|---|---|
| PubChem CID | 87594957 |
| Molecular Formula | C10H22O4S2Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | [diethoxy(methyl)silyl] 3,3-bis(sulfanyl)pentanoate |
| SMILES | CCO[Si](C)(OCC)OC(=O)CC(S)(S)CC |
| InChI | InChI=1S/C10H22O4S2Si/c1-5-10(15,16)8-9(11)14-17(4,12-6-2)13-7-3/h15-16H,5-8H2,1-4H3 |
| InChIKey | VXGHVKCOZMFXIN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|