C19H22FNO4S — CID 91189284
[4-[4-(2-aminopropyl)phenyl]sulfonyl-2-fluorophenyl] butanoate (PubChem CID 91189284) has the molecular formula C19H22FNO4S and a molecular weight of 379.45 g/mol. Its IUPAC name is [4-[4-(2-aminopropyl)phenyl]sulfonyl-2-fluorophenyl] butanoate.
| Compound Name | [4-[4-(2-aminopropyl)phenyl]sulfonyl-2-fluorophenyl] butanoate |
|---|---|
| PubChem CID | 91189284 |
| Molecular Formula | C19H22FNO4S |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | [4-[4-(2-aminopropyl)phenyl]sulfonyl-2-fluorophenyl] butanoate |
| SMILES | CCCC(=O)Oc1ccc(S(=O)(=O)c2ccc(CC(C)N)cc2)cc1F |
| InChI | InChI=1S/C19H22FNO4S/c1-3-4-19(22)25-18-10-9-16(12-17(18)20)26(23,24)15-7-5-14(6-8-15)11-13(2)21/h5-10,12-13H,3-4,11,21H2,1-2H3 |
| InChIKey | YNDJXASLGZHXRP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|