C21H21F4NO6S — CID 90788049
[2-fluoro-4-[4-[(2R)-2-[(2,2,2-trifluoroacetyl)amino]propyl]phenyl]sulfonylphenyl] butaneperoxoate (PubChem CID 90788049) has the molecular formula C21H21F4NO6S and a molecular weight of 491.46 g/mol. Its IUPAC name is [2-fluoro-4-[4-[(2R)-2-[(2,2,2-trifluoroacetyl)amino]propyl]phenyl]sulfonylphenyl] butaneperoxoate.
| Compound Name | [2-fluoro-4-[4-[(2R)-2-[(2,2,2-trifluoroacetyl)amino]propyl]phenyl]sulfonylphenyl] butaneperoxoate |
|---|---|
| PubChem CID | 90788049 |
| Molecular Formula | C21H21F4NO6S |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | [2-fluoro-4-[4-[(2R)-2-[(2,2,2-trifluoroacetyl)amino]propyl]phenyl]sulfonylphenyl] butaneperoxoate |
| SMILES | CCCC(=O)OOc1ccc(S(=O)(=O)c2ccc(C[C@@H](C)NC(=O)C(F)(F)F)cc2)cc1F |
| InChI | InChI=1S/C21H21F4NO6S/c1-3-4-19(27)32-31-18-10-9-16(12-17(18)22)33(29,30)15-7-5-14(6-8-15)11-13(2)26-20(28)21(23,24)25/h5-10,12-13H,3-4,11H2,1-2H3,(H,26,28)/t13-/m1/s1 |
| InChIKey | ULJIZVKUVLTJEC-CYBMUJFWSA-N |
| XLogP | 3.91 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|