C19H18F3NO6S — CID 91089960
[2-hydroxy-5-[4-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]phenyl]sulfonylphenyl] propanoate (PubChem CID 91089960) has the molecular formula C19H18F3NO6S and a molecular weight of 445.42 g/mol. Its IUPAC name is [2-hydroxy-5-[4-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]phenyl]sulfonylphenyl] propanoate.
| Compound Name | [2-hydroxy-5-[4-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]phenyl]sulfonylphenyl] propanoate |
|---|---|
| PubChem CID | 91089960 |
| Molecular Formula | C19H18F3NO6S |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | [2-hydroxy-5-[4-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]phenyl]sulfonylphenyl] propanoate |
| SMILES | CCC(=O)Oc1cc(S(=O)(=O)c2ccc(CCNC(=O)C(F)(F)F)cc2)ccc1O |
| InChI | InChI=1S/C19H18F3NO6S/c1-2-17(25)29-16-11-14(7-8-15(16)24)30(27,28)13-5-3-12(4-6-13)9-10-23-18(26)19(20,21)22/h3-8,11,24H,2,9-10H2,1H3,(H,23,26) |
| InChIKey | WENRSVWMBADOAB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|