C15H34O3SSi — CID 91189602
3-[tert-butyl-bis(2-methylpropyl)silyl]propane-1-sulfonic acid (PubChem CID 91189602) has the molecular formula C15H34O3SSi and a molecular weight of 322.59 g/mol. Its IUPAC name is 3-[tert-butyl-bis(2-methylpropyl)silyl]propane-1-sulfonic acid.
| Compound Name | 3-[tert-butyl-bis(2-methylpropyl)silyl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 91189602 |
| Molecular Formula | C15H34O3SSi |
| Molecular Weight | 322.59 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 3-[tert-butyl-bis(2-methylpropyl)silyl]propane-1-sulfonic acid |
| SMILES | CC(C)C[Si](CCCS(=O)(=O)O)(CC(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H34O3SSi/c1-13(2)11-20(12-14(3)4,15(5,6)7)10-8-9-19(16,17)18/h13-14H,8-12H2,1-7H3,(H,16,17,18) |
| InChIKey | ARIZNBCXLXCFIZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|