C16H23NO5S — CID 91191409
(R)-2,3-dihydro-1H-inden-2-yl-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methanesulfonic acid (PubChem CID 91191409) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is (R)-2,3-dihydro-1H-inden-2-yl-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methanesulfonic acid.
| Compound Name | (R)-2,3-dihydro-1H-inden-2-yl-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methanesulfonic acid |
|---|---|
| PubChem CID | 91191409 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (R)-2,3-dihydro-1H-inden-2-yl-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methanesulfonic acid |
| SMILES | CN(C(=O)OC(C)(C)C)[C@@H](C1Cc2ccccc2C1)S(=O)(=O)O |
| InChI | InChI=1S/C16H23NO5S/c1-16(2,3)22-15(18)17(4)14(23(19,20)21)13-9-11-7-5-6-8-12(11)10-13/h5-8,13-14H,9-10H2,1-4H3,(H,19,20,21)/t14-/m1/s1 |
| InChIKey | CHSTVXQOVCRHIO-CQSZACIVSA-N |
| XLogP | 2.48 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|