C13H9ClF3N6O2+ — CID 9119154
N-[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-3-nitropyridin-1-ium-2-amine (PubChem CID 9119154) has the molecular formula C13H9ClF3N6O2+ and a molecular weight of 373.70 g/mol. Its IUPAC name is N-[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-3-nitropyridin-1-ium-2-amine.
| Compound Name | N-[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-3-nitropyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 9119154 |
| Molecular Formula | C13H9ClF3N6O2+ |
| Molecular Weight | 373.70 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | N-[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-3-nitropyridin-1-ium-2-amine |
| SMILES | O=[N+]([O-])c1ccc[nH+]c1NCc1nnc2c(Cl)cc(C(F)(F)F)cn12 |
| InChI | InChI=1S/C13H8ClF3N6O2/c14-8-4-7(13(15,16)17)6-22-10(20-21-12(8)22)5-19-11-9(23(24)25)2-1-3-18-11/h1-4,6H,5H2,(H,18,19)/p+1 |
| InChIKey | LAFQZALLINXREY-UHFFFAOYSA-O |
| XLogP | 2.74 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.70 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|