C15H8ClF6N5O2 — CID 16572427
N-[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 16572427) has the molecular formula C15H8ClF6N5O2 and a molecular weight of 439.70 g/mol. Its IUPAC name is N-[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 16572427 |
| Molecular Formula | C15H8ClF6N5O2 |
| Molecular Weight | 439.70 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | N-[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1NCc1nnc2c(Cl)cc(C(F)(F)F)cn12 |
| InChI | InChI=1S/C15H8ClF6N5O2/c16-9-3-8(15(20,21)22)6-26-12(24-25-13(9)26)5-23-10-2-1-7(14(17,18)19)4-11(10)27(28)29/h1-4,6,23H,5H2 |
| InChIKey | SBMUWBCGEATFIR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.70 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|