C11H17NO3 — CID 91192685
6-ethoxy-3-(methoxymethoxy)-2,4-dimethylpyridine (PubChem CID 91192685) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 6-ethoxy-3-(methoxymethoxy)-2,4-dimethylpyridine.
| Compound Name | 6-ethoxy-3-(methoxymethoxy)-2,4-dimethylpyridine |
|---|---|
| PubChem CID | 91192685 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 6-ethoxy-3-(methoxymethoxy)-2,4-dimethylpyridine |
| SMILES | CCOc1cc(C)c(OCOC)c(C)n1 |
| InChI | InChI=1S/C11H17NO3/c1-5-14-10-6-8(2)11(9(3)12-10)15-7-13-4/h6H,5,7H2,1-4H3 |
| InChIKey | LJUPXIOMZHINJM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|