C20H26O4S2 — CID 10810657
2-(methoxymethoxy)-5-[4-(methoxymethoxy)-3,5-bis(methylsulfanyl)phenyl]-1,3-dimethylbenzene (PubChem CID 10810657) has the molecular formula C20H26O4S2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 2-(methoxymethoxy)-5-[4-(methoxymethoxy)-3,5-bis(methylsulfanyl)phenyl]-1,3-dimethylbenzene.
| Compound Name | 2-(methoxymethoxy)-5-[4-(methoxymethoxy)-3,5-bis(methylsulfanyl)phenyl]-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 10810657 |
| Molecular Formula | C20H26O4S2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2-(methoxymethoxy)-5-[4-(methoxymethoxy)-3,5-bis(methylsulfanyl)phenyl]-1,3-dimethylbenzene |
| SMILES | COCOc1c(C)cc(-c2cc(SC)c(OCOC)c(SC)c2)cc1C |
| InChI | InChI=1S/C20H26O4S2/c1-13-7-15(8-14(2)19(13)23-11-21-3)16-9-17(25-5)20(24-12-22-4)18(10-16)26-6/h7-10H,11-12H2,1-6H3 |
| InChIKey | ZURWQDJPJCUZME-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|