C17H25FO3S — CID 91193741
2-fluoro-4-propan-2-yl-1-(3-propan-2-yloxycyclopentyl)sulfonylbenzene (PubChem CID 91193741) has the molecular formula C17H25FO3S and a molecular weight of 328.45 g/mol. Its IUPAC name is 2-fluoro-4-propan-2-yl-1-(3-propan-2-yloxycyclopentyl)sulfonylbenzene.
| Compound Name | 2-fluoro-4-propan-2-yl-1-(3-propan-2-yloxycyclopentyl)sulfonylbenzene |
|---|---|
| PubChem CID | 91193741 |
| Molecular Formula | C17H25FO3S |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-fluoro-4-propan-2-yl-1-(3-propan-2-yloxycyclopentyl)sulfonylbenzene |
| SMILES | CC(C)OC1CCC(S(=O)(=O)c2ccc(C(C)C)cc2F)C1 |
| InChI | InChI=1S/C17H25FO3S/c1-11(2)13-5-8-17(16(18)9-13)22(19,20)15-7-6-14(10-15)21-12(3)4/h5,8-9,11-12,14-15H,6-7,10H2,1-4H3 |
| InChIKey | GESQIOWCUWFEAH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |