C20H22N6O2 — CID 91194041
1-(4-acetylphenyl)-3-[4-[(Z)-N-(4,5-dihydro-1H-imidazol-2-ylamino)-C-methylcarbonimidoyl]phenyl]urea (PubChem CID 91194041) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-3-[4-[(Z)-N-(4,5-dihydro-1H-imidazol-2-ylamino)-C-methylcarbonimidoyl]phenyl]urea.
| Compound Name | 1-(4-acetylphenyl)-3-[4-[(Z)-N-(4,5-dihydro-1H-imidazol-2-ylamino)-C-methylcarbonimidoyl]phenyl]urea |
|---|---|
| PubChem CID | 91194041 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 1-(4-acetylphenyl)-3-[4-[(Z)-N-(4,5-dihydro-1H-imidazol-2-ylamino)-C-methylcarbonimidoyl]phenyl]urea |
| SMILES | CC(=O)c1ccc(NC(=O)Nc2ccc(/C(C)=N\NC3=NCCN3)cc2)cc1 |
| InChI | InChI=1S/C20H22N6O2/c1-13(25-26-19-21-11-12-22-19)15-3-7-17(8-4-15)23-20(28)24-18-9-5-16(6-10-18)14(2)27/h3-10H,11-12H2,1-2H3,(H2,21,22,26)(H2,23,24,28)/b25-13- |
| InChIKey | RYHPUFJCTOYZTD-MXAYSNPKSA-N |
| XLogP | 2.81 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|