C22H29N7O2S — CID 91195144
N-[2-[(2-cyclohexylpropylamino)methyl]phenyl]-6-(tetrazol-1-yl)pyridine-3-sulfonamide (PubChem CID 91195144) has the molecular formula C22H29N7O2S and a molecular weight of 455.59 g/mol. Its IUPAC name is N-[2-[(2-cyclohexylpropylamino)methyl]phenyl]-6-(tetrazol-1-yl)pyridine-3-sulfonamide.
| Compound Name | N-[2-[(2-cyclohexylpropylamino)methyl]phenyl]-6-(tetrazol-1-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 91195144 |
| Molecular Formula | C22H29N7O2S |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | N-[2-[(2-cyclohexylpropylamino)methyl]phenyl]-6-(tetrazol-1-yl)pyridine-3-sulfonamide |
| SMILES | CC(CNCc1ccccc1NS(=O)(=O)c1ccc(-n2cnnn2)nc1)C1CCCCC1 |
| InChI | InChI=1S/C22H29N7O2S/c1-17(18-7-3-2-4-8-18)13-23-14-19-9-5-6-10-21(19)26-32(30,31)20-11-12-22(24-15-20)29-16-25-27-28-29/h5-6,9-12,15-18,23,26H,2-4,7-8,13-14H2,1H3 |
| InChIKey | NZGJUKBWDTUMMJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |