C26H33N3O3S — CID 91155480
N-[2-[(2-cyclohexylpropylamino)methyl]phenyl]-1-methyl-2-oxoquinoline-6-sulfonamide (PubChem CID 91155480) has the molecular formula C26H33N3O3S and a molecular weight of 467.64 g/mol. Its IUPAC name is N-[2-[(2-cyclohexylpropylamino)methyl]phenyl]-1-methyl-2-oxoquinoline-6-sulfonamide.
| Compound Name | N-[2-[(2-cyclohexylpropylamino)methyl]phenyl]-1-methyl-2-oxoquinoline-6-sulfonamide |
|---|---|
| PubChem CID | 91155480 |
| Molecular Formula | C26H33N3O3S |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | N-[2-[(2-cyclohexylpropylamino)methyl]phenyl]-1-methyl-2-oxoquinoline-6-sulfonamide |
| SMILES | CC(CNCc1ccccc1NS(=O)(=O)c1ccc2c(ccc(=O)n2C)c1)C1CCCCC1 |
| InChI | InChI=1S/C26H33N3O3S/c1-19(20-8-4-3-5-9-20)17-27-18-22-10-6-7-11-24(22)28-33(31,32)23-13-14-25-21(16-23)12-15-26(30)29(25)2/h6-7,10-16,19-20,27-28H,3-5,8-9,17-18H2,1-2H3 |
| InChIKey | ZWGRTYFECWKTAY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |