C23H31N3O4S — CID 69154090
[4-[[2-[(2-cyclohexylpropylamino)methyl]phenyl]sulfamoyl]phenyl] carbamate (PubChem CID 69154090) has the molecular formula C23H31N3O4S and a molecular weight of 445.59 g/mol. Its IUPAC name is [4-[[2-[(2-cyclohexylpropylamino)methyl]phenyl]sulfamoyl]phenyl] carbamate.
| Compound Name | [4-[[2-[(2-cyclohexylpropylamino)methyl]phenyl]sulfamoyl]phenyl] carbamate |
|---|---|
| PubChem CID | 69154090 |
| Molecular Formula | C23H31N3O4S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | [4-[[2-[(2-cyclohexylpropylamino)methyl]phenyl]sulfamoyl]phenyl] carbamate |
| SMILES | CC(CNCc1ccccc1NS(=O)(=O)c1ccc(OC(N)=O)cc1)C1CCCCC1 |
| InChI | InChI=1S/C23H31N3O4S/c1-17(18-7-3-2-4-8-18)15-25-16-19-9-5-6-10-22(19)26-31(28,29)21-13-11-20(12-14-21)30-23(24)27/h5-6,9-14,17-18,25-26H,2-4,7-8,15-16H2,1H3,(H2,24,27) |
| InChIKey | HCJAVCTVKUJENU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |