C24H17ClF3N5O2 — CID 91195325
6-chloro-8-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-3-(3,4,5-trifluorophenyl)imidazo[1,2-a]pyridin-2-ol (PubChem CID 91195325) has the molecular formula C24H17ClF3N5O2 and a molecular weight of 499.88 g/mol. Its IUPAC name is 6-chloro-8-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-3-(3,4,5-trifluorophenyl)imidazo[1,2-a]pyridin-2-ol.
| Compound Name | 6-chloro-8-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-3-(3,4,5-trifluorophenyl)imidazo[1,2-a]pyridin-2-ol |
|---|---|
| PubChem CID | 91195325 |
| Molecular Formula | C24H17ClF3N5O2 |
| Molecular Weight | 499.88 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | 6-chloro-8-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-3-(3,4,5-trifluorophenyl)imidazo[1,2-a]pyridin-2-ol |
| SMILES | COc1cc(Nc2cc(Cl)cn3c(-c4cc(F)c(F)c(F)c4)c(O)nc23)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C24H17ClF3N5O2/c1-12-9-32(11-29-12)19-4-3-15(8-20(19)35-2)30-18-7-14(25)10-33-22(24(34)31-23(18)33)13-5-16(26)21(28)17(27)6-13/h3-11,30,34H,1-2H3 |
| InChIKey | ZYZJAHBIJMANQA-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 76.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.88 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|