C23H28O4S — CID 91195731
ethyl 2-[3-(6-methoxynaphthalen-2-yl)but-1-en-2-ylsulfanylmethyl]-4-oxopentanoate (PubChem CID 91195731) has the molecular formula C23H28O4S and a molecular weight of 400.54 g/mol. Its IUPAC name is ethyl 2-[3-(6-methoxynaphthalen-2-yl)but-1-en-2-ylsulfanylmethyl]-4-oxopentanoate.
| Compound Name | ethyl 2-[3-(6-methoxynaphthalen-2-yl)but-1-en-2-ylsulfanylmethyl]-4-oxopentanoate |
|---|---|
| PubChem CID | 91195731 |
| Molecular Formula | C23H28O4S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | ethyl 2-[3-(6-methoxynaphthalen-2-yl)but-1-en-2-ylsulfanylmethyl]-4-oxopentanoate |
| SMILES | C=C(SCC(CC(C)=O)C(=O)OCC)C(C)c1ccc2cc(OC)ccc2c1 |
| InChI | InChI=1S/C23H28O4S/c1-6-27-23(25)21(11-15(2)24)14-28-17(4)16(3)18-7-8-20-13-22(26-5)10-9-19(20)12-18/h7-10,12-13,16,21H,4,6,11,14H2,1-3,5H3 |
| InChIKey | RKOZBEDTAGVKQT-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |