C22H22O5S2 — CID 91195749
ethyl 3-(4-methylphenyl)sulfanyl-2-[(4-methylphenyl)sulfanylmethyl]-4,5-dioxooxolane-2-carboxylate (PubChem CID 91195749) has the molecular formula C22H22O5S2 and a molecular weight of 430.55 g/mol. Its IUPAC name is ethyl 3-(4-methylphenyl)sulfanyl-2-[(4-methylphenyl)sulfanylmethyl]-4,5-dioxooxolane-2-carboxylate.
| Compound Name | ethyl 3-(4-methylphenyl)sulfanyl-2-[(4-methylphenyl)sulfanylmethyl]-4,5-dioxooxolane-2-carboxylate |
|---|---|
| PubChem CID | 91195749 |
| Molecular Formula | C22H22O5S2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | ethyl 3-(4-methylphenyl)sulfanyl-2-[(4-methylphenyl)sulfanylmethyl]-4,5-dioxooxolane-2-carboxylate |
| SMILES | CCOC(=O)C1(CSc2ccc(C)cc2)OC(=O)C(=O)C1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C22H22O5S2/c1-4-26-21(25)22(13-28-16-9-5-14(2)6-10-16)19(18(23)20(24)27-22)29-17-11-7-15(3)8-12-17/h5-12,19H,4,13H2,1-3H3 |
| InChIKey | BRYVVJYLZFUFLW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|