C17H17ClN4S — CID 9119985
3-(2-chlorophenyl)-5-(3-phenylpropylsulfanyl)-1,2,4-triazol-4-amine (PubChem CID 9119985) has the molecular formula C17H17ClN4S and a molecular weight of 344.87 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-5-(3-phenylpropylsulfanyl)-1,2,4-triazol-4-amine.
| Compound Name | 3-(2-chlorophenyl)-5-(3-phenylpropylsulfanyl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 9119985 |
| Molecular Formula | C17H17ClN4S |
| Molecular Weight | 344.87 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 3-(2-chlorophenyl)-5-(3-phenylpropylsulfanyl)-1,2,4-triazol-4-amine |
| SMILES | Nn1c(SCCCc2ccccc2)nnc1-c1ccccc1Cl |
| InChI | InChI=1S/C17H17ClN4S/c18-15-11-5-4-10-14(15)16-20-21-17(22(16)19)23-12-6-9-13-7-2-1-3-8-13/h1-5,7-8,10-11H,6,9,12,19H2 |
| InChIKey | PYAAXWMVDVTEGP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.87 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|