C24H24NO- — CID 91200994
ethane;2-methyl-4,4,5-triphenyl-5H-1,3-oxazole (PubChem CID 91200994) has the molecular formula C24H24NO- and a molecular weight of 342.46 g/mol. Its IUPAC name is ethane;2-methyl-4,4,5-triphenyl-5H-1,3-oxazole.
| Compound Name | ethane;2-methyl-4,4,5-triphenyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 91200994 |
| Molecular Formula | C24H24NO- |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | ethane;2-methyl-4,4,5-triphenyl-5H-1,3-oxazole |
| SMILES | CC1=NC(c2ccccc2)(c2ccccc2)C(c2ccccc2)O1.[CH2-]C |
| InChI | InChI=1S/C22H19NO.C2H5/c1-17-23-22(19-13-7-3-8-14-19,20-15-9-4-10-16-20)21(24-17)18-11-5-2-6-12-18;1-2/h2-16,21H,1H3;1H2,2H3/q;-1 |
| InChIKey | DUHPYBRBKFVVTK-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|