C19H20N2O2S — CID 9120102
(3-methyl-1-benzofuran-2-yl)-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone (PubChem CID 9120102) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is (3-methyl-1-benzofuran-2-yl)-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | (3-methyl-1-benzofuran-2-yl)-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 9120102 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (3-methyl-1-benzofuran-2-yl)-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone |
| SMILES | Cc1c(C(=O)N2CCN(Cc3cccs3)CC2)oc2ccccc12 |
| InChI | InChI=1S/C19H20N2O2S/c1-14-16-6-2-3-7-17(16)23-18(14)19(22)21-10-8-20(9-11-21)13-15-5-4-12-24-15/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | IADUDPZEXXUSQR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |