C23H31N3O2S — CID 91201716
1-(2,4-dimethoxy-5-propan-2-ylphenyl)-2-(1,3-dimethylindol-5-yl)ethanethione;hydrazine (PubChem CID 91201716) has the molecular formula C23H31N3O2S and a molecular weight of 413.59 g/mol. Its IUPAC name is 1-(2,4-dimethoxy-5-propan-2-ylphenyl)-2-(1,3-dimethylindol-5-yl)ethanethione;hydrazine.
| Compound Name | 1-(2,4-dimethoxy-5-propan-2-ylphenyl)-2-(1,3-dimethylindol-5-yl)ethanethione;hydrazine |
|---|---|
| PubChem CID | 91201716 |
| Molecular Formula | C23H31N3O2S |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 1-(2,4-dimethoxy-5-propan-2-ylphenyl)-2-(1,3-dimethylindol-5-yl)ethanethione;hydrazine |
| SMILES | COc1cc(OC)c(C(C)C)cc1C(=S)Cc1ccc2c(c1)c(C)cn2C.NN |
| InChI | InChI=1S/C23H27NO2S.H4N2/c1-14(2)17-11-19(22(26-6)12-21(17)25-5)23(27)10-16-7-8-20-18(9-16)15(3)13-24(20)4;1-2/h7-9,11-14H,10H2,1-6H3;1-2H2 |
| InChIKey | VSSOVFKQCYUZJC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|