About N-methylpropan-2-imine;propan-2-yl acetate
N-methylpropan-2-imine;propan-2-yl acetate (PubChem CID 91201865) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is N-methylpropan-2-imine;propan-2-yl acetate.
Molecular Properties
| Compound Name | N-methylpropan-2-imine;propan-2-yl acetate |
| PubChem CID | 91201865 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | N-methylpropan-2-imine;propan-2-yl acetate |
| SMILES | CC(=O)OC(C)C.CN=C(C)C |
| InChI | InChI=1S/C5H10O2.C4H9N/c1-4(2)7-5(3)6;1-4(2)5-3/h4H,1-3H3;1-3H3 |
| InChIKey | YKEASPBSMCSNMB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-methylpropan-2-imine;propan-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylpropan-2-imine;propan-2-yl acetate?
The IUPAC name of N-methylpropan-2-imine;propan-2-yl acetate (CID 91201865) is N-methylpropan-2-imine;propan-2-yl acetate.
What is the SMILES notation for N-methylpropan-2-imine;propan-2-yl acetate?
The canonical SMILES for N-methylpropan-2-imine;propan-2-yl acetate is CC(=O)OC(C)C.CN=C(C)C.
What is the InChIKey of N-methylpropan-2-imine;propan-2-yl acetate?
The InChIKey is YKEASPBSMCSNMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.C4H9N/c1-4(2)7-5(3)6;1-4(2)5-3/h4H,1-3H3;1-3H3.
What are the key properties of N-methylpropan-2-imine;propan-2-yl acetate?
N-methylpropan-2-imine;propan-2-yl acetate has a molecular weight of 173.26 g/mol, XLogP of 2.05, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylpropan-2-imine;propan-2-yl acetate is sourced from PubChem (CID 91201865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).