C52H24F24N4 — CID 91203819
5,10,15,20-tetrakis[3,5-bis(trifluoromethyl)phenyl]-21,22,23,24-tetrahydroporphyrin (PubChem CID 91203819) has the molecular formula C52H24F24N4 and a molecular weight of 1160.74 g/mol. Its IUPAC name is 5,10,15,20-tetrakis[3,5-bis(trifluoromethyl)phenyl]-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis[3,5-bis(trifluoromethyl)phenyl]-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 91203819 |
| Molecular Formula | C52H24F24N4 |
| Molecular Weight | 1160.74 g/mol |
| Exact Mass | 1160.16 |
| IUPAC Name | 5,10,15,20-tetrakis[3,5-bis(trifluoromethyl)phenyl]-21,22,23,24-tetrahydroporphyrin |
| SMILES | FC(F)(F)c1cc(C2=c3ccc([nH]3)=C(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c3ccc([nH]3)C(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)=c3ccc([nH]3)=C(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c3ccc2[nH]3)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C52H24F24N4/c53-45(54,55)25-9-21(10-26(17-25)46(56,57)58)41-33-1-2-34(77-33)42(22-11-27(47(59,60)61)18-28(12-22)48(62,63)64)36-5-6-38(79-36)44(24-15-31(51(71,72)73)20-32(16-24)52(74,75)76)40-8-7-39(80-40)43(37-4-3-35(41)78-37)23-13-29(49(65,66)67)19-30(14-23)50(68,69)70/h1-20,77-80H |
| InChIKey | DDWQLZMZISJPDE-UHFFFAOYSA-N |
| XLogP | 14.45 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1160.74 |
| LogP ≤ 5 | 14.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |