C9H14N2O3 — CID 91205176
1-methyl-3-morpholin-4-ylpyrrole-2,5-diol (PubChem CID 91205176) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 1-methyl-3-morpholin-4-ylpyrrole-2,5-diol.
| Compound Name | 1-methyl-3-morpholin-4-ylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 91205176 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 1-methyl-3-morpholin-4-ylpyrrole-2,5-diol |
| SMILES | Cn1c(O)cc(N2CCOCC2)c1O |
| InChI | InChI=1S/C9H14N2O3/c1-10-8(12)6-7(9(10)13)11-2-4-14-5-3-11/h6,12-13H,2-5H2,1H3 |
| InChIKey | IGAWKSBEBUWWOR-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 57.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |