C14H15BrN2O3 — CID 91475481
1-(4-bromophenyl)-3-morpholin-4-ylpyrrole-2,5-diol (PubChem CID 91475481) has the molecular formula C14H15BrN2O3 and a molecular weight of 339.19 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-morpholin-4-ylpyrrole-2,5-diol.
| Compound Name | 1-(4-bromophenyl)-3-morpholin-4-ylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 91475481 |
| Molecular Formula | C14H15BrN2O3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 1-(4-bromophenyl)-3-morpholin-4-ylpyrrole-2,5-diol |
| SMILES | Oc1cc(N2CCOCC2)c(O)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H15BrN2O3/c15-10-1-3-11(4-2-10)17-13(18)9-12(14(17)19)16-5-7-20-8-6-16/h1-4,9,18-19H,5-8H2 |
| InChIKey | PWTVBAGHHYNEMA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 57.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |