C21H20F3N3O2 — CID 91936381
1-phenyl-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrrole-2,5-diol (PubChem CID 91936381) has the molecular formula C21H20F3N3O2 and a molecular weight of 403.40 g/mol. Its IUPAC name is 1-phenyl-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrrole-2,5-diol.
| Compound Name | 1-phenyl-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91936381 |
| Molecular Formula | C21H20F3N3O2 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 1-phenyl-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrrole-2,5-diol |
| SMILES | Oc1cc(N2CCN(c3cccc(C(F)(F)F)c3)CC2)c(O)n1-c1ccccc1 |
| InChI | InChI=1S/C21H20F3N3O2/c22-21(23,24)15-5-4-8-17(13-15)25-9-11-26(12-10-25)18-14-19(28)27(20(18)29)16-6-2-1-3-7-16/h1-8,13-14,28-29H,9-12H2 |
| InChIKey | WJWOQKSXILZLMF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 51.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |