C20H20F3N3O3 — CID 20930241
3-acetamido-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]benzoic acid (PubChem CID 20930241) has the molecular formula C20H20F3N3O3 and a molecular weight of 407.39 g/mol. Its IUPAC name is 3-acetamido-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]benzoic acid.
| Compound Name | 3-acetamido-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 20930241 |
| Molecular Formula | C20H20F3N3O3 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 3-acetamido-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]benzoic acid |
| SMILES | CC(=O)Nc1cc(C(=O)O)ccc1N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H20F3N3O3/c1-13(27)24-17-11-14(19(28)29)5-6-18(17)26-9-7-25(8-10-26)16-4-2-3-15(12-16)20(21,22)23/h2-6,11-12H,7-10H2,1H3,(H,24,27)(H,28,29) |
| InChIKey | OYOFAFSNNCFUSL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |