C21H42N6O5 — CID 91205652
N-methyl-N'-[4-methyl-4-[2-[(2-methyl-3-nitrosobutan-2-yl)amino]oxyethylamino]-3-nitrosopentyl]heptanediamide (PubChem CID 91205652) has the molecular formula C21H42N6O5 and a molecular weight of 458.60 g/mol. Its IUPAC name is N-methyl-N'-[4-methyl-4-[2-[(2-methyl-3-nitrosobutan-2-yl)amino]oxyethylamino]-3-nitrosopentyl]heptanediamide.
| Compound Name | N-methyl-N'-[4-methyl-4-[2-[(2-methyl-3-nitrosobutan-2-yl)amino]oxyethylamino]-3-nitrosopentyl]heptanediamide |
|---|---|
| PubChem CID | 91205652 |
| Molecular Formula | C21H42N6O5 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.32 |
| IUPAC Name | N-methyl-N'-[4-methyl-4-[2-[(2-methyl-3-nitrosobutan-2-yl)amino]oxyethylamino]-3-nitrosopentyl]heptanediamide |
| SMILES | CNC(=O)CCCCCC(=O)NCCC(N=O)C(C)(C)NCCONC(C)(C)C(C)N=O |
| InChI | InChI=1S/C21H42N6O5/c1-16(25-30)20(2,3)27-32-15-14-24-21(4,5)17(26-31)12-13-23-19(29)11-9-7-8-10-18(28)22-6/h16-17,24,27H,7-15H2,1-6H3,(H,22,28)(H,23,29) |
| InChIKey | KARGFJLPCLBAAK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 150.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|