C19H19N5O2S — CID 91210018
2-[2-(2-bicyclo[2.2.1]hept-5-enylamino)-4-hydroxy-1,3-thiazol-5-yl]-N-(1H-indazol-6-yl)acetamide (PubChem CID 91210018) has the molecular formula C19H19N5O2S and a molecular weight of 381.46 g/mol. Its IUPAC name is 2-[2-(2-bicyclo[2.2.1]hept-5-enylamino)-4-hydroxy-1,3-thiazol-5-yl]-N-(1H-indazol-6-yl)acetamide.
| Compound Name | 2-[2-(2-bicyclo[2.2.1]hept-5-enylamino)-4-hydroxy-1,3-thiazol-5-yl]-N-(1H-indazol-6-yl)acetamide |
|---|---|
| PubChem CID | 91210018 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 2-[2-(2-bicyclo[2.2.1]hept-5-enylamino)-4-hydroxy-1,3-thiazol-5-yl]-N-(1H-indazol-6-yl)acetamide |
| SMILES | O=C(Cc1sc(NC2CC3C=CC2C3)nc1O)Nc1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C19H19N5O2S/c25-17(21-13-4-3-12-9-20-24-15(12)7-13)8-16-18(26)23-19(27-16)22-14-6-10-1-2-11(14)5-10/h1-4,7,9-11,14,26H,5-6,8H2,(H,20,24)(H,21,25)(H,22,23) |
| InChIKey | DYCGSMCVUUTIRK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|