C19H20BrN3O2S — CID 91199494
2-[2-(2-bicyclo[2.2.1]hept-5-enylamino)-4-hydroxy-1,3-thiazol-5-yl]-N-(4-bromophenyl)propanamide (PubChem CID 91199494) has the molecular formula C19H20BrN3O2S and a molecular weight of 434.36 g/mol. Its IUPAC name is 2-[2-(2-bicyclo[2.2.1]hept-5-enylamino)-4-hydroxy-1,3-thiazol-5-yl]-N-(4-bromophenyl)propanamide.
| Compound Name | 2-[2-(2-bicyclo[2.2.1]hept-5-enylamino)-4-hydroxy-1,3-thiazol-5-yl]-N-(4-bromophenyl)propanamide |
|---|---|
| PubChem CID | 91199494 |
| Molecular Formula | C19H20BrN3O2S |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 2-[2-(2-bicyclo[2.2.1]hept-5-enylamino)-4-hydroxy-1,3-thiazol-5-yl]-N-(4-bromophenyl)propanamide |
| SMILES | CC(C(=O)Nc1ccc(Br)cc1)c1sc(NC2CC3C=CC2C3)nc1O |
| InChI | InChI=1S/C19H20BrN3O2S/c1-10(17(24)21-14-6-4-13(20)5-7-14)16-18(25)23-19(26-16)22-15-9-11-2-3-12(15)8-11/h2-7,10-12,15,25H,8-9H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | ZZBYGAXCTVDQNM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|