C48H42N4O5S — CID 91210274
benzhydryl (2S,3R)-3-(carbamoyloxymethyl)-3-methyl-7-oxo-6-[[4-[(tritylamino)methyl]-2-pyridinyl]methylidene]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 91210274) has the molecular formula C48H42N4O5S and a molecular weight of 786.95 g/mol. Its IUPAC name is benzhydryl (2S,3R)-3-(carbamoyloxymethyl)-3-methyl-7-oxo-6-[[4-[(tritylamino)methyl]-2-pyridinyl]methylidene]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzhydryl (2S,3R)-3-(carbamoyloxymethyl)-3-methyl-7-oxo-6-[[4-[(tritylamino)methyl]-2-pyridinyl]methylidene]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 91210274 |
| Molecular Formula | C48H42N4O5S |
| Molecular Weight | 786.95 g/mol |
| Exact Mass | 786.29 |
| IUPAC Name | benzhydryl (2S,3R)-3-(carbamoyloxymethyl)-3-methyl-7-oxo-6-[[4-[(tritylamino)methyl]-2-pyridinyl]methylidene]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@@]1(COC(N)=O)SC2C(=Cc3cc(CNC(c4ccccc4)(c4ccccc4)c4ccccc4)ccn3)C(=O)N2[C@H]1C(=O)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C48H42N4O5S/c1-47(32-56-46(49)55)42(45(54)57-41(34-17-7-2-8-18-34)35-19-9-3-10-20-35)52-43(53)40(44(52)58-47)30-39-29-33(27-28-50-39)31-51-48(36-21-11-4-12-22-36,37-23-13-5-14-24-37)38-25-15-6-16-26-38/h2-30,41-42,44,51H,31-32H2,1H3,(H2,49,55)/t42-,44?,47-/m0/s1 |
| InChIKey | ANGKPSSWHVAYOB-XQUUSULHSA-N |
| XLogP | 8.02 |
| TPSA | 123.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.95 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|