C29H28N4O5 — CID 158951254
benzhydryl (2R,3R,6E)-3-(hydrazinecarbonyloxymethyl)-3-methyl-7-oxo-6-(pyridin-2-ylmethylidene)-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 158951254) has the molecular formula C29H28N4O5 and a molecular weight of 512.57 g/mol. Its IUPAC name is benzhydryl (2R,3R,6E)-3-(hydrazinecarbonyloxymethyl)-3-methyl-7-oxo-6-(pyridin-2-ylmethylidene)-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzhydryl (2R,3R,6E)-3-(hydrazinecarbonyloxymethyl)-3-methyl-7-oxo-6-(pyridin-2-ylmethylidene)-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 158951254 |
| Molecular Formula | C29H28N4O5 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | benzhydryl (2R,3R,6E)-3-(hydrazinecarbonyloxymethyl)-3-methyl-7-oxo-6-(pyridin-2-ylmethylidene)-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@@]1(COC(=O)NN)CC2/C(=C\c3ccccn3)C(=O)N2[C@H]1C(=O)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H28N4O5/c1-29(18-37-28(36)32-30)17-23-22(16-21-14-8-9-15-31-21)26(34)33(23)25(29)27(35)38-24(19-10-4-2-5-11-19)20-12-6-3-7-13-20/h2-16,23-25H,17-18,30H2,1H3,(H,32,36)/b22-16+/t23?,25-,29-/m0/s1 |
| InChIKey | JLLLAJDTYILPRC-UBYBVCRBSA-N |
| XLogP | 3.39 |
| TPSA | 123.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|