C28H25IN2O3 — CID 159178536
benzhydryl (2R,6Z)-6-[iodo(pyridin-2-yl)methylidene]-3,3-dimethyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 159178536) has the molecular formula C28H25IN2O3 and a molecular weight of 564.42 g/mol. Its IUPAC name is benzhydryl (2R,6Z)-6-[iodo(pyridin-2-yl)methylidene]-3,3-dimethyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzhydryl (2R,6Z)-6-[iodo(pyridin-2-yl)methylidene]-3,3-dimethyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 159178536 |
| Molecular Formula | C28H25IN2O3 |
| Molecular Weight | 564.42 g/mol |
| Exact Mass | 564.09 |
| IUPAC Name | benzhydryl (2R,6Z)-6-[iodo(pyridin-2-yl)methylidene]-3,3-dimethyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)CC2/C(=C(/I)c3ccccn3)C(=O)N2[C@H]1C(=O)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H25IN2O3/c1-28(2)17-21-22(23(29)20-15-9-10-16-30-20)26(32)31(21)25(28)27(33)34-24(18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-16,21,24-25H,17H2,1-2H3/b23-22-/t21?,25-/m0/s1 |
| InChIKey | UWHBVLOLRJTMGH-IZFPNCAASA-N |
| XLogP | 5.57 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.42 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|