C34H27N3O9S — CID 59142476
benzhydryl (2S,5R,6E)-3,3-dimethyl-6-[2-(4-nitrophenoxy)-2-oxo-1-pyridin-2-ylethylidene]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 59142476) has the molecular formula C34H27N3O9S and a molecular weight of 653.67 g/mol. Its IUPAC name is benzhydryl (2S,5R,6E)-3,3-dimethyl-6-[2-(4-nitrophenoxy)-2-oxo-1-pyridin-2-ylethylidene]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzhydryl (2S,5R,6E)-3,3-dimethyl-6-[2-(4-nitrophenoxy)-2-oxo-1-pyridin-2-ylethylidene]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 59142476 |
| Molecular Formula | C34H27N3O9S |
| Molecular Weight | 653.67 g/mol |
| Exact Mass | 653.15 |
| IUPAC Name | benzhydryl (2S,5R,6E)-3,3-dimethyl-6-[2-(4-nitrophenoxy)-2-oxo-1-pyridin-2-ylethylidene]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)/C(=C(\C(=O)Oc3ccc([N+](=O)[O-])cc3)c3ccccn3)[C@H]2S1(=O)=O |
| InChI | InChI=1S/C34H27N3O9S/c1-34(2)29(33(40)46-28(21-11-5-3-6-12-21)22-13-7-4-8-14-22)36-30(38)27(31(36)47(34,43)44)26(25-15-9-10-20-35-25)32(39)45-24-18-16-23(17-19-24)37(41)42/h3-20,28-29,31H,1-2H3/b27-26+/t29-,31+/m0/s1 |
| InChIKey | FPHMSHDKHWHFRH-DPTHVMHXSA-N |
| XLogP | 4.43 |
| TPSA | 163.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.67 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|