C8H14N2 — CID 91212517
N,N'-bis(prop-1-enyl)ethanimidamide (PubChem CID 91212517) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is N,N'-bis(prop-1-enyl)ethanimidamide.
| Compound Name | N,N'-bis(prop-1-enyl)ethanimidamide |
|---|---|
| PubChem CID | 91212517 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N,N'-bis(prop-1-enyl)ethanimidamide |
| SMILES | CC=C/N=C(\C)NC=CC |
| InChI | InChI=1S/C8H14N2/c1-4-6-9-8(3)10-7-5-2/h4-7H,1-3H3,(H,9,10) |
| InChIKey | ZQALRZKMQTYXOQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|