C11H9F3N2OS — CID 91213014
N-[[4-(trifluoromethoxy)phenyl]methyl]-1,3-thiazol-4-amine (PubChem CID 91213014) has the molecular formula C11H9F3N2OS and a molecular weight of 274.27 g/mol. Its IUPAC name is N-[[4-(trifluoromethoxy)phenyl]methyl]-1,3-thiazol-4-amine.
| Compound Name | N-[[4-(trifluoromethoxy)phenyl]methyl]-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 91213014 |
| Molecular Formula | C11H9F3N2OS |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | N-[[4-(trifluoromethoxy)phenyl]methyl]-1,3-thiazol-4-amine |
| SMILES | FC(F)(F)Oc1ccc(CNc2cscn2)cc1 |
| InChI | InChI=1S/C11H9F3N2OS/c12-11(13,14)17-9-3-1-8(2-4-9)5-15-10-6-18-7-16-10/h1-4,6-7,15H,5H2 |
| InChIKey | NDIFPQAZBOYEMD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |