C36H43N5O4 — CID 91213085
[6-(2,3-dimethylphenyl)-2-[4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl] N-(2-ethyl-4-methoxyphenyl)carbamate (PubChem CID 91213085) has the molecular formula C36H43N5O4 and a molecular weight of 609.77 g/mol. Its IUPAC name is [6-(2,3-dimethylphenyl)-2-[4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl] N-(2-ethyl-4-methoxyphenyl)carbamate.
| Compound Name | [6-(2,3-dimethylphenyl)-2-[4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl] N-(2-ethyl-4-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 91213085 |
| Molecular Formula | C36H43N5O4 |
| Molecular Weight | 609.77 g/mol |
| Exact Mass | 609.33 |
| IUPAC Name | [6-(2,3-dimethylphenyl)-2-[4-(3-piperidin-1-ylpropoxy)anilino]pyrimidin-4-yl] N-(2-ethyl-4-methoxyphenyl)carbamate |
| SMILES | CCc1cc(OC)ccc1NC(=O)Oc1cc(-c2cccc(C)c2C)nc(Nc2ccc(OCCCN3CCCCC3)cc2)n1 |
| InChI | InChI=1S/C36H43N5O4/c1-5-27-23-30(43-4)17-18-32(27)39-36(42)45-34-24-33(31-12-9-11-25(2)26(31)3)38-35(40-34)37-28-13-15-29(16-14-28)44-22-10-21-41-19-7-6-8-20-41/h9,11-18,23-24H,5-8,10,19-22H2,1-4H3,(H,39,42)(H,37,38,40) |
| InChIKey | GHVIVPLHRIANNP-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.77 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|