C13H17N3OS — CID 91213777
1-(5-amino-2-phenyl-2-propyl-1,3,4-thiadiazol-3-yl)ethanone (PubChem CID 91213777) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is 1-(5-amino-2-phenyl-2-propyl-1,3,4-thiadiazol-3-yl)ethanone.
| Compound Name | 1-(5-amino-2-phenyl-2-propyl-1,3,4-thiadiazol-3-yl)ethanone |
|---|---|
| PubChem CID | 91213777 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 1-(5-amino-2-phenyl-2-propyl-1,3,4-thiadiazol-3-yl)ethanone |
| SMILES | CCCC1(c2ccccc2)SC(N)=NN1C(C)=O |
| InChI | InChI=1S/C13H17N3OS/c1-3-9-13(11-7-5-4-6-8-11)16(10(2)17)15-12(14)18-13/h4-8H,3,9H2,1-2H3,(H2,14,15) |
| InChIKey | MRWYUXMMEACEOH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |