C18H28Cl2N3O6PS2 — CID 91214047
dichloromethane;ethane;ethyl 1-phosphanylsulfonyl-3-piperazin-1-ylsulfonylindole-2-carboxylate (PubChem CID 91214047) has the molecular formula C18H28Cl2N3O6PS2 and a molecular weight of 548.45 g/mol. Its IUPAC name is dichloromethane;ethane;ethyl 1-phosphanylsulfonyl-3-piperazin-1-ylsulfonylindole-2-carboxylate.
| Compound Name | dichloromethane;ethane;ethyl 1-phosphanylsulfonyl-3-piperazin-1-ylsulfonylindole-2-carboxylate |
|---|---|
| PubChem CID | 91214047 |
| Molecular Formula | C18H28Cl2N3O6PS2 |
| Molecular Weight | 548.45 g/mol |
| Exact Mass | 547.05 |
| IUPAC Name | dichloromethane;ethane;ethyl 1-phosphanylsulfonyl-3-piperazin-1-ylsulfonylindole-2-carboxylate |
| SMILES | CC.CCOC(=O)c1c(S(=O)(=O)N2CCNCC2)c2ccccc2n1S(=O)(=O)P.ClCCl |
| InChI | InChI=1S/C15H20N3O6PS2.C2H6.CH2Cl2/c1-2-24-15(19)13-14(26(20,21)17-9-7-16-8-10-17)11-5-3-4-6-12(11)18(13)27(22,23)25;1-2;2-1-3/h3-6,16H,2,7-10,25H2,1H3;1-2H3;1H2 |
| InChIKey | HEUHSSGARXYSJO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|