C14H18N5O3+ — CID 91214278
(2R,7S,8R)-5,5,11-trimethyl-4,6,18-trioxa-1,12,15-triaza-10-azoniapentacyclo[8.6.1.12,8.03,7.014,17]octadeca-10(17),11,13,15-tetraen-13-amine (PubChem CID 91214278) has the molecular formula C14H18N5O3+ and a molecular weight of 304.33 g/mol. Its IUPAC name is (2R,7S,8R)-5,5,11-trimethyl-4,6,18-trioxa-1,12,15-triaza-10-azoniapentacyclo[8.6.1.12,8.03,7.014,17]octadeca-10(17),11,13,15-tetraen-13-amine.
| Compound Name | (2R,7S,8R)-5,5,11-trimethyl-4,6,18-trioxa-1,12,15-triaza-10-azoniapentacyclo[8.6.1.12,8.03,7.014,17]octadeca-10(17),11,13,15-tetraen-13-amine |
|---|---|
| PubChem CID | 91214278 |
| Molecular Formula | C14H18N5O3+ |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (2R,7S,8R)-5,5,11-trimethyl-4,6,18-trioxa-1,12,15-triaza-10-azoniapentacyclo[8.6.1.12,8.03,7.014,17]octadeca-10(17),11,13,15-tetraen-13-amine |
| SMILES | Cc1nc(N)c2ncn3c2[n+]1C[C@H]1O[C@@H]3C2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C14H17N5O3/c1-6-17-11(15)8-12-18(6)4-7-9-10(22-14(2,3)21-9)13(20-7)19(12)5-16-8/h5,7,9-10,13,15H,4H2,1-3H3/p+1/t7-,9+,10?,13-/m1/s1 |
| InChIKey | WHHUDOQQVOWWNQ-ZIUXOXTBSA-O |
| XLogP | 0.04 |
| TPSA | 88.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|